ADT-007 | MedChemExpress (MCE)
ADT-007 is a potent and orally active pan-RAS inhibitor with strong anticancer effects. ADT-007 binds RAS in a nucleotide-free conformation to block GTP activation. ADT-007 potently and selectively inhibits the growth of cancer cells with mutated or hyper-activated wild-type RAS isozymes[1].
| Trivial name | ADT-007 |
| Catalog Number | HY-157887 |
| Research Area | Cancer |
| CAS# | 1945941-09-2 |
| Purity | ≥98.0% |
| SMILES | O=C(NCC1=CC=CO1)CC2=C(C)/C(C3=CC=C(F)C=C32)=C/C4=CC(OC)=C(C(OC)=C4)O |
| Size | 10 mg |
| Supplier Page | https://www.medchemexpress.com/adt-007.html |