β-Aminoarteether maleate | MedChemExpress (MCE)
β-Aminoarteether maleate (SM934) is an Artemisinin derivative with orally active. β-Aminoarteether maleate can be used for inflammation and autoimmune disease research, such as lupus diseases[1].
| Trivial name | β-Aminoarteether maleate |
| Catalog Number | HY-137553A |
| Alternative Name(s) | SM934 |
| Research Area | Inflammation/Immunology |
| CAS# | 133162-25-1 |
| Purity | ≥98.0% |
| SMILES | C[C@@H]1[C@@](CC[C@H]2C)([H])[C@@]([C@@]2([H])CC3)(OO4)[C@@](O[C@@H]1OCCN)([H])O[C@@]34C.O=C(O)/C=C\C(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/β-aminoarteether-maleate.html |