2′-Hydroxyflavanone | MedChemExpress (MCE)
2′-Hydroxyflavanone is a flavanone that can inhibit cancer cell proliferation, induce apoptosis, and reduce inflammation. 2′-Hydroxyflavanone shows inhibitory effect on platelet aggregation caused by two inducers with IC50s 47.8 μM arachidonic acid (AA) and 147.2 μM aenosine diphosphate (ADP)[1].
| Trivial name | 2'-Hydroxyflavanone |
| Catalog Number | HY-134556 |
| Research Area | Inflammation/Immunology; Cancer |
| CAS# | 17348-76-4 |
| Purity | ≥98.0% |
| SMILES | O=C1CC(C2=CC=CC=C2O)OC3=CC=CC=C13 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/2-hydroxyflavanone.html |