Urdamycin B | MedChemExpress (MCE)
Urdamycin B is an antibiotic that effectively inhibits fungi and bacteria. Urdamycin B also exhibits anti-proliferative activity against mouse leukemia cells L1210. Urdamycin B can be obtained from the metabolic products of Streptomyces fradiae. Urdamycin B can be used for research on cancer as well as bacterial and fungal infections[1][2].
| Trivial name | Urdamycin B |
| Catalog Number | HY-N8519 |
| Research Area | Infection; Cancer |
| CAS# | 104542-46-3 |
| Purity | ≥98.0% |
| SMILES | O=C1C2=C(C(C3=C(O)C([C@H]4C[C@H]([C@@H]([C@H](O4)C)O)O[C@@H]5O[C@H]([C@H](CC5)O[C@H]6C[C@H]([C@@H]([C@H](O6)C)O)O)C)=CC=C31)=O)C=CC(C[C@@](O)(C7)C)=C2C7=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/urdamycin-b.html |