UCM-13369 | MedChemExpress (MCE)
UCM-13369 (Compound 4b) is a NPM1 inhibitor. UCM-13369 downregulates the pathway associated with mutant NPM1 C+, and specifically recognizes the C-end DNA-binding domain of NPM1 C+. UCM-13369 induces apoptosis in AML cell lines and primary cells, that can be used for the research of AML[1].
| Trivial name | UCM-13369 |
| Catalog Number | HY-162265 |
| Research Area | Cancer |
| CAS# | 2921944-77-4 |
| Purity | ≥98.0% |
| SMILES | N[C@@H]([C@@H]1CCNCC2CC2)[C@@H](C3=CC=C(OC)C=C3)CC4=C1C5=C(N4)C=CC=C5 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ucm-13369.html |