PD-1/PD-L1-IN-40 | MedChemExpress (MCE)
PD-1/PD-L1-IN-40 (Compound EP16) is a PD-1/PD-L1 inhibitor. PD-1/PD-L1-IN-40 inhibits the generation of exosomal PD-L1 with IC50 = 0.108 μM. PD-1/PD-L1-IN-40 can serve as a leading compound for exosomal PD-L1 abrogation. PD-1/PD-L1-IN-40 can be used for the research of cancer[1].
| Trivial name | PD-1/PD-L1-IN-40 |
| Catalog Number | HY-157811 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | O=C(C1=CC=C(C=C1)C2=CC3=C(NC=C3)N=C2)NCCN4CCOCC4 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/pd-1-pd-l1-in-40.html |