CAY10506 | MedChemExpress (MCE)
CAY10506 is a PPARγ ligand that can induce cell death and ROS production in a PPARγ-dependent manner in vitro. CAY10506 exhibits radiosensitizing effects, enhancing γ-radiations-induced apoptosis and caspase-3-mediated poly (ADP-ribose) polymerase (PARP) cleavage. CAY10506 can be used in cancer research[1].
| Trivial name | CAY10506 |
| Catalog Number | HY-118988 |
| Research Area | Cancer |
| CAS# | 292615-75-9 |
| Purity | ≥98.0% |
| SMILES | O=C1SC(CC2=CC=C(C=C2)OCCNC(CCCCC3SSCC3)=O)C(N1)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/cay10506.html |