QPy-TPA | MedChemExpress (MCE)
QPy-TPA is a lipopjilc probes, which induces non-ferroptotic cell death and lipid dynamic regularion in B16 and HepG2 cells upon light irradiation. QPy-TPA reveals a maximum absorption wavelength of 400 nm and a maximum emission wavelength of 590 nm[1].
| Trivial name | QPy-TPA |
| Catalog Number | HY-163287 |
| Research Area | Others |
| CAS# | 2738332-94-8 |
| Purity | ≥98.0% |
| SMILES | O=C1C2=CC=CC=C2NC(C3=CC(/C=C/C(C=C4)=CC=C4N(C5=CC=CC=C5)C6=CC=CC=C6)=CC=N3)=N1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/qpy-tpa.html |