CDC20-IN-1 | MedChemExpress (MCE)
CDC20-IN-1 (Compound E1) is a specific inhibitor of CDC20 and can be used in triple-negative breast cancer research. CDC20-IN-1 can induce autophagy in cancer cells and inhibit MDA-MB-231 cell proliferation, with an IC50 value of 1.43 μM[1].
| Trivial name | CDC20-IN-1 |
| Catalog Number | HY-161257 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | O=C(CC)NC(C(Cl)(Cl)Cl)N(C=N1)C2=C1C(NC3=CC(OC)=C(OC)C(OC)=C3)=NC(N)=N2 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/cdc20-in-1.html |