GPX4-IN-9 | MedChemExpress (MCE)
GPX4-IN-9 (Compound A16) is a glutathione peroxidase 4 (GPX4) inhibitor that specifically targets GPX4 under both in vitro and in vivo conditions, inducing ferroptosis. GPX4-IN-9 exhibits cytotoxicity against pancreatic cancer cells and can be used in cancer research[1].
| Trivial name | GPX4-IN-9 |
| Catalog Number | HY-157762 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | O=S(C(C=C1)=CC=C1CN(C2=CC=C(C=C2)C3=NC4=C(S3)C=CC=C4)CC#C)(N(C#C)C)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/gpx4-in-9.html |