Coumarin–quinone conjugate | MedChemExpress (MCE)
Coumarin–quinone conjugate is a fluorescent substrate for NADH:ubiquinone oxidoreductases which consists of a coumarin fluorophore and a ubiquinone analog. Coumarin–quinone conjugate can be used to measure the kinetic parameters of AIFM2/FSP1 for researches such as ferroptosis[1].
| Trivial name | Coumarin–quinone conjugate |
| Catalog Number | HY-157744 |
| CAS# | 2741190-31-6 |
| Purity | ≥98.0% |
| SMILES | O=C1OC2=C(C=C1C(OCC(C(C(C)=C3C)=O)=C(C)C3=O)=O)C=CC(N(CC)CC)=C2 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/coumarin-quinone-conjugate.html |