DL-threo-PDMP hydrochloride | MedChemExpress (MCE)
DL-threo-PDMP hydrochloride is the hydrochloride form of DL-threo-PDMP that is a competitive glucosylceramide synthase (GCS) inhibitor. DL-threo-PDMP resensitizes refractory testicular germ cell tumors and epithelial ovarian cancer orthoxenografts to cisplatin in mice[1].
| Trivial name | DL-threo-PDMP hydrochloride |
| Catalog Number | HY-116392B |
| Research Area | Cancer |
| CAS# | 80938-69-8 |
| Purity | ≥98.0% |
| SMILES | O[C@H](C1=CC=CC=C1)[C@H](NC(CCCCCCCCC)=O)CN2CCOCC2.Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/dl-threo-pdmp-hydrochloride.html |