17-HDHA | MedChemExpress (MCE)
17-HDHA is a DHA-derived specialized proresolving mediator (SPM). 17-HDHA enhances the antibody-mediated immune response against influenza virus. 17-HDHA enhances the differentiation of B cells toward the CD27+ CD38+ antibody-secreting cell phenotype, thereby strongly increasing IgM and IgG production by activated B cells[1][2].
| Trivial name | 17-HDHA |
| Catalog Number | HY-113512 |
| Research Area | Inflammation/Immunology |
| CAS# | 90780-52-2 |
| Purity | ≥98.0% |
| SMILES | CC/C=C\CC(O)/C=C/C=C\C/C=C\C/C=C\C/C=C\CCC(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/17-hdha.html |