FSY-OSO2F | MedChemExpress (MCE)
FSY-OSO2F is used as an amino acid tracer for subsutaneous MCF-7 tumors after labeling with isotope 18F. FSY-OSO2F shows an uptake in MCF-7 cells through the regulation of L-Tyr, ASC, and ASC2 transporters. FSY-OSO2F visualizes the U78MG glioma labeled with 18F[1].
| Trivial name | FSY-OSO2F |
| Catalog Number | HY-163281 |
| Research Area | Cancer |
| CAS# | 1839622-49-9 |
| Purity | ≥98.0% |
| SMILES | O=C(O)[C@@H](N)CC1=CC=C(OS(=O)(F)=O)C=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/fsy-oso2f.html |