Anticancer agent 187 | MedChemExpress (MCE)
Anticancer agent 187 (Compound 4) is an anticancer agent that can target sarcoma cells in tumor-bearing mouse models. Anticancer agent 187 exhibits cytotoxic activity against HepG2, Caco2, and MCF-7 cells[1].
| Trivial name | Anticancer agent 187 |
| Catalog Number | HY-162239 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | O=C(OCC)C1=C(C)N=C(N)C(C#N)=C1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)CNC2=CC=CC(O)=C2 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/anticancer-agent-187.html |