Penicisteck acid F | MedChemExpress (MCE)
Penicisteck acid F (Compound 2) is a Marine derived tanzanic acid derivative that is a NF-κB inhibitor. Penicisteck acid F inhibits osteoclast expression by decreasing RANKL-induced IκBα degradation, NF-κB p65 nuclear translocation, NFATc1 activation and nuclear translocation, and related mRNA expression. Penicisteck acid F can be used in osteoporosis research[1].
| Trivial name | Penicisteck acid F |
| Catalog Number | HY-N12604 |
| Research Area | Others |
| Purity | ≥98.0% |
| SMILES | C[C@@H](C[C@H](C1=C(C(C)=CC=C1)/C=C/C=C/C(O)=O)C)CO |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/penicisteck-acid-f.html |