Methyl betulonate | MedChemExpress (MCE)
Methyl betulonate (Betulonic acid methyl ester) is a triterpenoid. Methyl betulonate inhibits cell growth of eight tumor (including resistant) and two normal fibroblast cell lines with the IC50s >50.0 μM[1].
| Trivial name | Methyl betulonate |
| Catalog Number | HY-W773183 |
| Alternative Name(s) | Betulonic acid methyl ester; Methyl 3-oxolup-20(29)-en-28-oate |
| Research Area | Cancer |
| CAS# | 4356-31-4 |
| Purity | ≥98.0% |
| SMILES | COC([C@]12[C@@]([C@@H](CC2)C(C)=C)([H])[C@]3([H])[C@@](CC1)([C@]4([C@]([C@@]5([C@@](C(C)(C(CC5)=O)C)([H])CC4)C)([H])CC3)C)C)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/methyl-betulonate.html |
