CTPS1-IN-1 | MedChemExpress (MCE)
CTPS1-IN-1 (compound R80) is a CTPS1 inhibitor. CTPS1-IN-1 has the potential to research cancer (such as promoting vascular injury or surgical recovery) and immune system diseases (such as rejection of transplanted cells and tissues, transplant-related diseases or disorders, allergies, and autoimmune diseases)[1].
| Trivial name | CTPS1-IN-1 |
| Catalog Number | HY-157746 |
| Research Area | Inflammation/Immunology; Cancer |
| CAS# | 2341943-12-0 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=NC=C(C2=CN=CC(OCC)=N2)C=C1)NC3(CC3)C4=CSC(NS(=O)(C5CC5)=O)=N4 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ctps1-in-1.html |