3-Oxo-C16:1 | MedChemExpress (MCE)
3-Oxo-C16:1 could induce changes in root protein production in the model legume Medicago truncatula. 3-Oxo-C16:1 is an unsaturated 16-carbon AHL utilized by species such as S. meliloti and Agrobacterium vitus[1].
| Trivial name | 3-Oxo-C16:1 |
| Catalog Number | HY-118040 |
| Research Area | Metabolic Disease |
| CAS# | 1269663-80-0 |
| Purity | ≥98.0% |
| SMILES | CCCC/C=C\CCCCCCCC(CC(N[C@@H]1C(OCC1)=O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/3-oxo-c16-1.html |