Lenalidomide 5′-piperazine | MedChemExpress (MCE)
Lenalidomide 5′-piperazine is a functionalized cerebellar ligand for PROTAC development that binds an E3 ligand to terminal piperazine for subsequent chemical reactions to produce a protein deactivator with a rigid linker[1].
| Trivial name | Lenalidomide 5'-piperazine |
| Catalog Number | HY-W259932 |
| Research Area | Cancer |
| CAS# | 2222120-31-0 |
| Purity | 98.6% |
| SMILES | O=C1NC(C(CC1)N2C(C3=CC=C(N4CCNCC4)C=C3C2)=O)=O.Cl |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/lenalidomide-5-piperazine.html |