CBI1 | MedChemExpress (MCE)
CBI1 is a covalent BAX inhibitor. CBI1 selectively derivatizes BAX at C126 and inhibits BAX activation by triggering ligands or point mutagenesis. CBI1 blocks t-2-hex lipidation and oligomerization of BAX. CBI1 inhibits BAX activation induced by BH3 ligands, F116A mutagenesis or t-2-hex[1].
| Trivial name | CBI1 |
| Catalog Number | HY-161242 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | BrC1=CC=C(C2=NNC(C(NCCCSSCCN)=O)=C2)C=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/cbi1.html |