Lenalidomide 5′-piperazine-4-methylpiperidine hydrochloride | MedChemExpress (MCE)
Lenalidomide 5′-piperazine-4-methylpiperidine hydrochloride is a functionalized cerebellar ligand for PROTAC development, combining E3 ligand and terminal piperidine for subsequent chemical reactions. A protein degradant with a rigid connector is generated[1].
| Trivial name | Lenalidomide 5'-piperazine-4-methylpiperidine hydrochloride |
| Catalog Number | HY-157566 |
| Research Area | Cancer |
| CAS# | 2520105-60-4 |
| Purity | ≥98.0% |
| SMILES | O=C1NC(C(CC1)N2C(C3=CC=C(N4CCN(CC5CCNCC5)CC4)C=C3C2)=O)=O.Cl.Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lenalidomide-5-piperazine-4-methylpiperidine-hydrochloride.html |