7(S)-Maresin 1 | MedChemExpress (MCE)
7(S)-Maresin 1 is an inactive 7(S) exomer of Maresin 1, containing a 7(R) hydroxyl group. It can be used as a negative control. Maresin 1 is a specific regulator of endogenous DHA production in the human body, which can stimulate the production and secretion of intracellular Ca2+[1].
| Trivial name | 7(S)-Maresin 1 |
| Catalog Number | HY-116429A |
| Research Area | Inflammation/Immunology |
| CAS# | 1268720-66-6 |
| Purity | ≥98.0% |
| SMILES | CC/C=C\C/C=C\C[C@H](O)/C=C\C=C\C=C\[C@@H](O)C/C=C\CCC(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/7-s-maresin-1.html |