SF5 | MedChemExpress (MCE)
SF5 (2,2-Diphenylethyl isothiocyanate) is a sulforaphane analog. SF5 inhibits apoptosis by the JNK-p53-caspase pathway. SF5 can be used as a new renal protective agent for drug-resistant acute renal disease[1].
| Trivial name | SF5 |
| Catalog Number | HY-116794 |
| Alternative Name(s) | 2,2-Diphenylethyl isothiocyanate |
| Research Area | Cancer |
| CAS# | 34634-22-5 |
| Purity | 99.8% |
| SMILES | S=C=NCC(C1=CC=CC=C1)C2=CC=CC=C2 |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/sf5.html |