Galbinic acid | MedChemExpress (MCE)
Galbinic acid (α-Acetylsalazinic acid), a lichen acid, shows antibacterial activities against the Gram-positive bacteria B. cereus, B. subtilis, and S. aureus (MICs=62.5, 62.5, 250 μg/ml, respectively). Galbinic acid inhibits the Gram-negative bacterium E. coli (MIC=125 μg/ml)[1][2].
| Trivial name | Galbinic acid |
| Catalog Number | HY-N12096 |
| Alternative Name(s) | α-Acetylsalazinic acid |
| Research Area | Infection |
| CAS# | 56691-88-4 |
| Purity | ≥98.0% |
| SMILES | O=CC1=C(C=C(C)C2=C1OC(C3=C(C(O)=C4COC(C)=O)C(OC3O)=O)=C4OC2=O)O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/galbinic-acid.html |