2,6-Dimethylpyrazine-d6 | MedChemExpress (MCE)
2,6-Dimethylpyrazine-d6 is deuterated labeled Beauvericin (HY-N6739). Beauvericin is a Fusarium mycotoxin. Beauvericin inhibits acyl-CoA: cholesterol acyltransferase (ACAT) activity with an IC50 of 3 μM in an enzyme assay using rat liver microsomes[1].
| Trivial name | 2,6-Dimethylpyrazine-d6 |
| Catalog Number | HY-W040790S |
| Research Area | Others |
| CAS# | 1335402-00-0 |
| Purity | ≥98.0% |
| SMILES | [2H]C(C1=CN=CC(C([2H])([2H])[2H])=N1)([2H])[2H] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/2-6-dimethylpyrazine-d6.html |