trans-2-Nonenal-d2 | MedChemExpress (MCE)
trans-2-Nonenal-d2 is deuterated labeled Acetylpyrazine (HY-W007692). Acetylpyrazine (2-Acetylpyrazine) is used to form many polycyclic compounds, as useful structures in pharmaceuticals and perfumes. Acetylpyrazine is a component of the folates (vitamin B compounds)[1].
| Trivial name | trans-2-Nonenal-d2 |
| Catalog Number | HY-W089800S |
| Alternative Name(s) | trans-2-Nonen-1-al-d2 |
| Research Area | Others |
| CAS# | 213595-54-1 |
| Purity | ≥98.0% |
| SMILES | CCCCCC/C([2H])=C([2H])/C=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/trans-2-nonenal-d2.html |