Nerol-d6 | MedChemExpress (MCE)
Nerol-d6 is deuterated labeled Oct-1-en-3-ol (HY-W010410). Oct-1-en-3-ol, a fatty acid fragrant, is a self-stimulating oxylipin messenger. Oct-1-en-3-ol serves as a signaling molecule in plant cellular responses, plant-herbivore interactions, and plant-plant interactions. Oct-1-en-3-ol causes dopamine neuron degeneration through disruption of dopamine handling[1][2].
| Trivial name | Nerol-d6 |
| Catalog Number | HY-N7063S1 |
| CAS# | 66063-45-4 |
| Purity | ≥98.0% |
| SMILES | [2H]C([2H])([2H])/C(C([2H])([2H])[2H])=C/CC/C(C)=C\CO |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/nerol-d6.html |