Isoeugenol-d3 | MedChemExpress (MCE)
Isoeugenol-d3 is deuterated labeled Sterigmatocystine (HY-N6725). Sterigmatocystine is a precursor of aflatoxins and a mycotoxin produced by common mold strains from Aspergillus versicolor[1][2]. Sterigmatocystine, a inhibitor of G1 Phase and DNA synthesis, is used to inhibit p21 activity. Sterigmatocystine has teratogenic, and carcinogenic effects in animals[3].
| Trivial name | Isoeugenol-d3 |
| Catalog Number | HY-N1952S |
| Alternative Name(s) | iso-Eugenol-d3 |
| Research Area | Infection |
| CAS# | 1668553-92-1 |
| Purity | ≥98.0% |
| SMILES | [2H]C([2H])([2H])OC1=CC(/C=C/C)=CC=C1O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/isoeugenol-d3.html |