Prednisone-d4 | MedChemExpress (MCE)
Prednisone-d4 is deuterated labeled Prednisone (HY-B0214). Prednisone (Adasone) is a corticosteroid agent with anti-inflammatory and immunosuppressive effects that can be used to study diseases related to systemic lupus erythematosus[1][2].
| Trivial name | Prednisone-d4 |
| Catalog Number | HY-B0214S2 |
| Alternative Name(s) | Dehydrocortisone-d4 |
| Research Area | Inflammation/Immunology; Endocrinology; Cancer |
| Purity | ≥98.0% |
| SMILES | C[C@@]1(C2([2H])[2H])[C@](C(C([2H])([2H])O)=O)(O)CC[C@@]1([H])[C@]3([H])CCC4=CC(C=C[C@]4(C)[C@@]3([H])C2=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/prednisone-d4.html |