Pomalidomide-15N,13C5 | MedChemExpress (MCE)
Pomalidomide-15N,13C5 is 15N and 13C labeled Pomalidomide (HY-10984). Pomalidomide, the third-generation immunomodulatory agent, acts as molecular glue. Pomalidomide interacts with the E3 ligase cereblon and induces degradation of essential Ikaros transcription factors.
| Trivial name | Pomalidomide-15N,13C5 |
| Catalog Number | HY-10984S3 |
| Alternative Name(s) | CC-4047-15N,13C5 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | O=C1N(C(C2=C1C=CC=C2N)=O)[13C]([13C]([15NH]3)=O)[13C][13C][13C]3=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/pomalidomide-15n-13c5.html |