Oxypurinol-13C,15N2 | MedChemExpress (MCE)
Oxypurinol-13C,15N2 is 15N and 13C labeled Oxypurinol (HY-19657). Oxipurinol (Oxipurinol), the major active metabolite of Allopurinol, is an inhibitor of xanthine oxidase. Oxipurinol can be used to regulate blood urate levels and treat gout[1].
| Trivial name | Oxypurinol-13C,15N2 |
| Catalog Number | HY-19657S |
| Alternative Name(s) | Oxypurinol-13C,15N2 |
| Research Area | Metabolic Disease; Inflammation/Immunology |
| Purity | ≥98.0% |
| SMILES | OC1=C2C([15NH][15N]=C2)=N[13C](O)=N1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/oxypurinol-13c-15n2.html |