Moexipril-d3 | MedChemExpress (MCE)
Moexipril-d3 is deuterated labeled Moexipril (HY-117281). Moexipril is an orally active inhibitor of angiotensin-converting enzyme (ACE), and becomes effective by being hydrolyzed to moexiprila hydrochloride. Moexipril exhibits antihypertensive and neuroprotective effects[1]–[4].
| Trivial name | Moexipril-d3 |
| Catalog Number | HY-117281S1 |
| Research Area | Neurological Disease; Cardiovascular Disease |
| Purity | ≥98.0% |
| SMILES | O=C([C@H]1N(C([C@@H](N[C@H](C(OCC)=O)CCC2=CC=CC=C2)C([2H])([2H])[2H])=O)CC3=C(C=C(OC)C(OC)=C3)C1)O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/moexipril-d3.html |