Mirtazapine-d4 hydrochloride | MedChemExpress (MCE)
Mirtazapine-d4 hydrochloride is deuterated labeled Mirtazapine (HY-B0352). Mirtazapine (Org3770) is a potent and orally active noradrenergic and specific serotonergic antidepressant (NaSSA) agent. Mirtazapine is also a 5-HT2, 5-HT3, histamine H1 receptor and α2-adrenoceptor antagonist with pKi values of 8.05, 8.1, 9.3 and 6.95, respectively[1][2].
| Trivial name | Mirtazapine-d4 hydrochloride |
| Catalog Number | HY-B0352S3 |
| Research Area | Neurological Disease; Inflammation/Immunology; Cancer |
| CAS# | 1215587-73-7 |
| Purity | ≥98.0% |
| SMILES | CN1CC2C3=CC=CC=C3CC4=CC=CN=C4N2C([2H])([2H])C1([2H])[2H].Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mirtazapine-d4-hydrochloride.html |