Lenvatinib-15N,d4 | MedChemExpress (MCE)
Lenvatinib-15N,d4 is 15N and deuterated labeled Lenvatinib (HY-10981). Lenvatinib (E7080) is an oral, multi-targeted tyrosine kinase inhibitor that inhibits VEGFR1-3, FGFR1-4, PDGFR, KIT, and RET, shows potent antitumor activities[1][2].
| Trivial name | Lenvatinib-15N,d4 |
| Catalog Number | HY-10981S2 |
| Alternative Name(s) | E7080-15N,d4 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | O=C(C1=C(OC)C=C2N=CC=C(OC3=CC(Cl)=C(NC(NC4C([2H])(C4([2H])[2H])[2H])=O)C=C3)C2=C1)[15NH2] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lenvatinib-15n-d4.html |