Irinotecan-d5 hydrochloride | MedChemExpress (MCE)
Irinotecan-d5 hydrochloride is deuterated labeled Irinotecan hydrochloride (HY-16562A). Irinotecan hydrochloride ((+)-Irinotecan hydrochloride) is a topoisomerase I inhibitor mainly used to treat colon cancer and rectal cancer[1].
| Trivial name | Irinotecan-d5 hydrochloride |
| Catalog Number | HY-16562AS |
| Alternative Name(s) | (+)-Irinotecan-d5 hydrochloride; CPT-11-d5 hydrochloride; VAL-413-d5 |
| Research Area | Cancer |
| CAS# | 718612-73-8 |
| Purity | ≥98.0% |
| SMILES | O=C(OC1=CC=C2N=C3C(CN4C(C(CO5)=C(C=C43)[C@](CC)(O)C5=O)=O)=C(C2=C1)C([2H])(C([2H])([2H])[2H])[2H])N6CCC(CC6)N7CCCCC7.Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/irinotecan-d5-hydrochloride.html |