Ebastine-d6 | MedChemExpress (MCE)
Ebastine-d6 is deuterated labeled Ebastine (HY-B0674). Ebastine (LAS-W 090) is an orally active, second-generation histamine H1 receptor antagonist. Ebastine can be used for the symptoms of allergic rhinitis and chronic idiopathic urticaria research[1].
| Trivial name | Ebastine-d6 |
| Catalog Number | HY-B0674S1 |
| Alternative Name(s) | LAS-W 090-d6; RP64305-d6 |
| Research Area | Inflammation/Immunology; Endocrinology |
| Purity | ≥98.0% |
| SMILES | O=C(C1=CC=C(C=C1)C(C)(C)C)CCCN(CC2)CCC2OC(C3=CC=CC=C3)([2H])C4=C([2H])C([2H])=C([2H])C([2H])=C4[2H] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ebastine-d6.html |