Debutyldronedarone-d7 hydrochloride | MedChemExpress (MCE)
Debutyldronedarone-d7 hydrochloride is deuterated labeled Debutyldronedarone hydrochloride (HY-12753A). Debutyldronedarone (SR35021) hydrochloride, the main metabolite of Dronedarone, is a selective thyroid hormone receptor α1 (TRα1) inhibitor. Debutyldronedarone hydrochloride inhibits T3 binding to TRα1 and TRβ1 by 77% and 25%, respectively. Debutyldronedarone hydrochloride can be used for the research of arrhythmic[1].
| Trivial name | Debutyldronedarone-d7 hydrochloride |
| Catalog Number | HY-12753AS |
| Alternative Name(s) | SR35021-d7 hydrochloride |
| Research Area | Cardiovascular Disease |
| Purity | ≥98.0% |
| SMILES | [2H]C([2H])(C([2H])(CNCCCOC1=CC=C(C=C1)C(C2=C(OC3=C2C=C(C=C3)NS(C)(=O)=O)CCCC)=O)[2H])C([2H])([2H])[2H].Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/debutyldronedarone-d7-hydrochloride.html |