Asenapine-13C,d3 | MedChemExpress (MCE)
Asenapine-13C,d3 is 13C and deuterated labeled Asenapine (HY-10121). Asenapine (Org 5222), an atypical antipsychotic, is an antagonist of serotonin receptors (pKi: 8.4-10.5), adrenoceptors (pKi: 8.9-9.5), dopamine receptors (pKi: 8.9-9.4) and histamine receptors (pKi: 8.2-9.0). Asenapine can be used in the research of schizophrenia and bipolar disorder[1][2].
| Trivial name | Asenapine-13C,d3 |
| Catalog Number | HY-10121S2 |
| Alternative Name(s) | Org 5222-13C,d3 |
| Research Area | Neurological Disease; Endocrinology |
| CAS# | 2747915-30-4 |
| Purity | ≥98.0% |
| SMILES | ClC1=CC(C2C(CN(C2)[13C]([2H])([2H])[2H])C3=C4C=CC=C3)=C(O4)C=C1.O=C(O)/C=C\C(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/asenapine-13c-d3.html |