Amodiaquine-d10 hydrochloride | MedChemExpress (MCE)
Amodiaquine-d10 hydrochloride is deuterated labeled Amodiaquine (HY-B1322A). Amodiaquine (Amodiaquin), a 4-aminoquinoline class of antimalarial agent, is a potent and orally active histamine N-methyltransferase inhibitor. Amodiaquine is also a Nurr1 agonist and specifically binds to Nurr1-LBD (ligand binding domain) with an EC50 of ~20 μM. Anti-inflammatory effect[1][2][3][4].
| Trivial name | Amodiaquine-d10 hydrochloride |
| Catalog Number | HY-B1322AS1 |
| Alternative Name(s) | Amodiaquin-d10 |
| Research Area | Neurological Disease; Inflammation/Immunology; Infection |
| Purity | ≥98.0% |
| SMILES | ClC(C=C1)=CC2=C1C(NC3=CC(CN(C([2H])([2H])C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])[2H])=C(C=C3)O)=CC=N2.Cl.Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/amodiaquine-d10-hydrochloride.html |