N-Acetylglycine-d2 | MedChemExpress (MCE)
N-Acetylglycine-d2 (Aceturic acid-d2; Acetamidoacetic acid-d2) is the deuterated labeled N-Acetylglycine (HY-Y0069). N-Acetylglycine (Aceturic acid) is a minor constituent of numerous foods with no genotoxicity or acute toxicity. N-acetylglycine is used in biological research of peptidomimetics[1].
| Trivial name | N-Acetylglycine-d2 |
| Catalog Number | HY-Y0069S1 |
| Alternative Name(s) | Aceturic acid-d2; Acetamidoacetic acid-d2 |
| Research Area | Others |
| CAS# | 4905-36-6 |
| Purity | ≥98.0% |
| SMILES | [2H]C(NC(C)=O)([2H])C(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/n-acetylglycine-d2.html |