Maribavir-d6 TFA | MedChemExpress (MCE)
Maribavir-d6 TFA (1263W94-d6 TFA; BW1263W94-d6 TFA; GW257406X-d6 TFA) is a deuterium labeled Maribavir (HY-16305). Maribavir is an orally active antiviral agent for cytomegalovirus (CMV) through inhibition of protein kinase UL97 and the following CMV DNA replication[1].
| Trivial name | Maribavir-d6 TFA |
| Catalog Number | HY-16305S1 |
| Alternative Name(s) | 1263W94-d6 TFA; BW1263W94-d6 TFA; GW257406X-d6 TFA |
| Research Area | Infection |
| Purity | ≥98.0% |
| SMILES | ClC1=C(Cl)C=C2C(N=C(NC(C([2H])([2H])[2H])C([2H])([2H])[2H])N2[C@@H]3[C@@H](O)[C@@H](O)[C@H](CO)O3)=C1.O=C(O)C(F)(F)F |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/maribavir-d6-tfa.html |