Adenosine-d9 | MedChemExpress (MCE)
Adenosine-d9 is the deuterium labeled Adenosine. Adenosine (Adenine riboside), a ubiquitous endogenous autacoid, acts through the enrollment of four G protein-coupled receptors: A1, A2A, A2B, and A3. Adenosine affects almost all aspects of cellular physio[1][2].
| Trivial name | Adenosine-d9 |
| Catalog Number | HY-B0228S14 |
| Alternative Name(s) | Adenine riboside-d9; D-Adenosine-d9 |
| Research Area | Others |
| Purity | ≥98.0% |
| SMILES | [2H]N([2H])C1=C(N=C([2H])N2[C@H]3[C@H](O[2H])[C@H](O[2H])[C@@H](C([2H])([2H])O[2H])O3)C2=NC([2H])=N1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/adenosine-d9.html |