Uridine-13C9,15N2 | MedChemExpress (MCE)
Uridine-13C9,15N2 (β-Uridine-13C9,15N2) is 13C and 15N labeled Uridine (HY-B1449). Uridine is a glycosylated pyrimidine-analog containing uracil attached to a ribose ring (or more specifically, aribofuranose) via a β-N1-glycosidic bond[1].
| Trivial name | Uridine-13C9,15N2 |
| Catalog Number | HY-W751165 |
| Alternative Name(s) | β-Uridine-13C9,15N2 |
| Research Area | Cancer |
| CAS# | 202406-84-6 |
| Purity | ≥98.0% |
| SMILES | O[13C@H]1[13C@@H](O[13C@H]([13CH2]O)[13C@H]1O)[15N]2[13C](=O)[15NH][13C](=O)[13CH]=[13CH]2 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/uridine-13c9-15n2.html |