Tranexamic acid-13C2,15N | MedChemExpress (MCE)
Tranexamic acid-13C2,15N (Cyclocapron-13C2,15N) is the 13C2 and 15N labeled Tranexamic acid. Tranexamic acid is an antifibrinolytic agent that alleviates liver damage and fibrosis in mouse models of chronic bile duct injury[1][2].
| Trivial name | Tranexamic acid-13C2,15N |
| Catalog Number | HY-B0149S3 |
| Alternative Name(s) | Cyclocapron-13C2,15N |
| Research Area | Inflammation/Immunology |
| CAS# | 1292837-95-6 |
| Purity | ≥98.0% |
| SMILES | O[13C]([C@@H]1CC[C@H](CC1)[13CH2][15NH2])=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/tranexamic-acid-13c2-15n.html |