VB124
VB124, a potent and selective MCT4 inhibitor, specifically inhibits lactate efflux/import in MDA-MB-231 cells expressing MCT4, and is used for the research of cardiac hypertrophy, heart failure, and metabolism.
| Catalog Number | S9929 |
| Molecular Formula | C23H23ClN2O4 |
| CAS# | 2230186-18-0 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC(C)(OCC1=N[N](C2=C(Cl)C=CC=C2)C(=C1)C3=CC(=CC=C3)OC4CC4)C(O)=O |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/vb124.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s9929-vb124-chemical-structure.gif |