Elimusertib (BAY-1895344)
Elimusertib (BAY-1895344) is a very potent and highly selective ATR (ataxia telangiectasia and Rad3-related) inhibitor with IC50 of 7 nM. Elimusertib potently inhibits proliferation of a broad spectrum of human tumor cell lines with median IC50 of 78 nM.
| Trivial name | N/A |
| Catalog Number | S9864 |
| Molecular Formula | C20H21N7O |
| CAS# | 1876467-74-1 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1COCCN1C2=CC(=C3C=CN=C(C4=CC=N[NH]4)C3=N2)C5=CC=N[N]5C |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/elimusertib-bay-1895344-.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s9864-bay-1895344-chemical-structure.gif |