DTHIB
DTHIB (Direct Targeted HSF1 InhiBitor) is a direct and selective inhibitor of heat shock factor 1 (HSF1) with Kd of 160 nM for DTHIB binding to the HSF1 DNA binding domain (DBD). DTHIB exhibits potently anticancer activities.
| Trivial name | N/A |
| Catalog Number | S9806 |
| Molecular Formula | C13H9ClFN3O3 |
| CAS# | 897326-30-6 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | [O-][N+](=O)C1=CC(=CC=C1Cl)NC(=O)NC2=CC=C(F)C=C2 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/dthib.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s9806-dthib-chemical-structure.gif |