Rimiducid (AP1903)
Rimiducid (AP1903) is a chemical protein dimerizer and binds tightly to the target FKBP fusion protein while binding minimally to the abundant natural FKBP. Rimiducid elicites potent and dose-dependent apoptosis of cells in culture expressing dimerizer-dependent Fas constructs, with an EC50 of ≈0.1 nM.
| Trivial name | N/A |
| Catalog Number | S9726 |
| Molecular Formula | C78H98N4O20 |
| CAS# | 195514-63-7 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CCC(C(=O)N1CCCCC1C(=O)OC(CCC2=CC(=C(OC)C=C2)OC)C3=CC(=CC=C3)OCC(=O)NCCNC(=O)COC4=CC=CC(=C4)C(CCC5=CC(=C(OC)C=C5)OC)OC(=O)C6CCCCN6C(=O)C(CC)C7=CC(=C(OC)C(=C7)OC)OC)C8=CC(=C(OC)C(=C8)OC)OC |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/rimiducid-ap1903.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s9726-rimiducid-ap1903-chemical-structure.gif |