BX471
BX471 (ZK811752, BAY 865047, SH T 04268H) is a potent nonpeptide CC chemokine receptor-1 (CCR1) antagonist with Ki values of 1 nM and 5.5 nM in both MIP-1α and MCP-3 binding to CCR1-transfected HEK293 cells, respectively.
| Trivial name | ZK811752, BAY 865047, SH T 04268H |
| Catalog Number | S7604 |
| Molecular Formula | C21H24ClFN4O3 |
| CAS# | 217645-70-0 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1CN(CCN1C(=O)COC2=C(NC(N)=O)C=C(Cl)C=C2)CC3=CC=C(F)C=C3 |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/bx471.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s7604-zk811752-bx471-chemical-structure.gif |